C22H24ClN3O5 — CID 27700758
methyl (3S)-3-(4-chlorophenyl)-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]propanoate (PubChem CID 27700758) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is methyl (3S)-3-(4-chlorophenyl)-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]propanoate.
| Compound Name | methyl (3S)-3-(4-chlorophenyl)-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 27700758 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | methyl (3S)-3-(4-chlorophenyl)-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)C[C@H](NC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClN3O5/c1-31-21(27)14-18(15-6-8-17(23)9-7-15)24-22(28)16-10-12-25(13-11-16)19-4-2-3-5-20(19)26(29)30/h2-9,16,18H,10-14H2,1H3,(H,24,28)/t18-/m0/s1 |
| InChIKey | ZXGOCTZXZOMTED-SFHVURJKSA-N |
| XLogP | 3.89 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|