C17H25N5O4S — CID 9160710
1-[(2S)-1-methoxypropan-2-yl]-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]thiourea (PubChem CID 9160710) has the molecular formula C17H25N5O4S and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-[(2S)-1-methoxypropan-2-yl]-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]thiourea.
| Compound Name | 1-[(2S)-1-methoxypropan-2-yl]-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 9160710 |
| Molecular Formula | C17H25N5O4S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[(2S)-1-methoxypropan-2-yl]-3-[[1-(2-nitrophenyl)piperidine-4-carbonyl]amino]thiourea |
| SMILES | COC[C@H](C)NC(=S)NNC(=O)C1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H25N5O4S/c1-12(11-26-2)18-17(27)20-19-16(23)13-7-9-21(10-8-13)14-5-3-4-6-15(14)22(24)25/h3-6,12-13H,7-11H2,1-2H3,(H,19,23)(H2,18,20,27)/t12-/m0/s1 |
| InChIKey | HYHYCQKGPJAOQX-LBPRGKRZSA-N |
| XLogP | 1.34 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|