C13H14F3N3O3 — CID 95625612
(2R)-1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 95625612) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is (2R)-1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95625612 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (2R)-1-(2-nitrophenyl)-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)[C@H]1CCCN1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14F3N3O3/c14-13(15,16)8-17-12(20)11-6-3-7-18(11)9-4-1-2-5-10(9)19(21)22/h1-2,4-5,11H,3,6-8H2,(H,17,20)/t11-/m1/s1 |
| InChIKey | HAQNNIFWQUSTCG-LLVKDONJSA-N |
| XLogP | 2.24 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|