C15H18F3N3O3 — CID 47070656
1-[2-(4-nitrophenyl)ethyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide (PubChem CID 47070656) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-[2-(4-nitrophenyl)ethyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(4-nitrophenyl)ethyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 47070656 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 1-[2-(4-nitrophenyl)ethyl]-N-(2,2,2-trifluoroethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCN1CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18F3N3O3/c16-15(17,18)10-19-14(22)13-2-1-8-20(13)9-7-11-3-5-12(6-4-11)21(23)24/h3-6,13H,1-2,7-10H2,(H,19,22) |
| InChIKey | IQISRMBLLQNYHH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|