C17H21N5O4S — CID 55447351
N-methyl-3-nitro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]benzenesulfonamide (PubChem CID 55447351) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is N-methyl-3-nitro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]benzenesulfonamide.
| Compound Name | N-methyl-3-nitro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 55447351 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | N-methyl-3-nitro-4-[4-(pyridin-2-ylmethyl)piperazin-1-yl]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N2CCN(Cc3ccccn3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H21N5O4S/c1-18-27(25,26)15-5-6-16(17(12-15)22(23)24)21-10-8-20(9-11-21)13-14-4-2-3-7-19-14/h2-7,12,18H,8-11,13H2,1H3 |
| InChIKey | GSGJJLBSHWWFJR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 108.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|