C15H23N3O5S2 — CID 133479469
4-(2,2-diethyl-1-oxo-1,4-thiazinan-4-yl)-N-methyl-3-nitrobenzenesulfonamide (PubChem CID 133479469) has the molecular formula C15H23N3O5S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-(2,2-diethyl-1-oxo-1,4-thiazinan-4-yl)-N-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 4-(2,2-diethyl-1-oxo-1,4-thiazinan-4-yl)-N-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133479469 |
| Molecular Formula | C15H23N3O5S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 4-(2,2-diethyl-1-oxo-1,4-thiazinan-4-yl)-N-methyl-3-nitrobenzenesulfonamide |
| SMILES | CCC1(CC)CN(c2ccc(S(=O)(=O)NC)cc2[N+](=O)[O-])CCS1=O |
| InChI | InChI=1S/C15H23N3O5S2/c1-4-15(5-2)11-17(8-9-24(15)21)13-7-6-12(25(22,23)16-3)10-14(13)18(19)20/h6-7,10,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | GEKIWSHYYGQPLE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|