C15H19N5O7S3 — CID 24621064
N-methyl-4-[4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 24621064) has the molecular formula C15H19N5O7S3 and a molecular weight of 477.55 g/mol. Its IUPAC name is N-methyl-4-[4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-methyl-4-[4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24621064 |
| Molecular Formula | C15H19N5O7S3 |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | N-methyl-4-[4-[(4-methyl-2-oxo-3H-1,3-thiazol-5-yl)sulfonyl]piperazin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(N2CCN(S(=O)(=O)c3sc(=O)[nH]c3C)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H19N5O7S3/c1-10-14(28-15(21)17-10)30(26,27)19-7-5-18(6-8-19)12-4-3-11(29(24,25)16-2)9-13(12)20(22)23/h3-4,9,16H,5-8H2,1-2H3,(H,17,21) |
| InChIKey | XOEFJMDQHLTYHL-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 162.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|