C16H18N4O6S2 — CID 16962586
4-methyl-5-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]sulfonyl-3H-1,3-thiazol-2-one (PubChem CID 16962586) has the molecular formula C16H18N4O6S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 4-methyl-5-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]sulfonyl-3H-1,3-thiazol-2-one.
| Compound Name | 4-methyl-5-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]sulfonyl-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 16962586 |
| Molecular Formula | C16H18N4O6S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 4-methyl-5-[4-(3-methyl-4-nitrobenzoyl)piperazin-1-yl]sulfonyl-3H-1,3-thiazol-2-one |
| SMILES | Cc1cc(C(=O)N2CCN(S(=O)(=O)c3sc(=O)[nH]c3C)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O6S2/c1-10-9-12(3-4-13(10)20(23)24)14(21)18-5-7-19(8-6-18)28(25,26)15-11(2)17-16(22)27-15/h3-4,9H,5-8H2,1-2H3,(H,17,22) |
| InChIKey | YIMSTZUHOUGJJI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|