C18H28N4O6S — CID 55985959
tert-butyl N-methyl-N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-3-yl]methyl]carbamate (PubChem CID 55985959) has the molecular formula C18H28N4O6S and a molecular weight of 428.51 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 55985959 |
| Molecular Formula | C18H28N4O6S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | tert-butyl N-methyl-N-[[1-(2-nitro-4-sulfamoylphenyl)piperidin-3-yl]methyl]carbamate |
| SMILES | CN(CC1CCCN(c2ccc(S(N)(=O)=O)cc2[N+](=O)[O-])C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N4O6S/c1-18(2,3)28-17(23)20(4)11-13-6-5-9-21(12-13)15-8-7-14(29(19,26)27)10-16(15)22(24)25/h7-8,10,13H,5-6,9,11-12H2,1-4H3,(H2,19,26,27) |
| InChIKey | IAYHLLZCBYJCBU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|