C18H26ClN3O4 — CID 60563491
tert-butyl N-[[1-(2-chloro-4-nitrophenyl)piperidin-3-yl]methyl]-N-methylcarbamate (PubChem CID 60563491) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-chloro-4-nitrophenyl)piperidin-3-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[1-(2-chloro-4-nitrophenyl)piperidin-3-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 60563491 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl N-[[1-(2-chloro-4-nitrophenyl)piperidin-3-yl]methyl]-N-methylcarbamate |
| SMILES | CN(CC1CCCN(c2ccc([N+](=O)[O-])cc2Cl)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26ClN3O4/c1-18(2,3)26-17(23)20(4)11-13-6-5-9-21(12-13)16-8-7-14(22(24)25)10-15(16)19/h7-8,10,13H,5-6,9,11-12H2,1-4H3 |
| InChIKey | GAXRNISUYWIHSW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|