C12H15ClN2O3 — CID 174760958
1-(2-chloro-4-nitrophenyl)-3-methoxypiperidine (PubChem CID 174760958) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-3-methoxypiperidine.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-3-methoxypiperidine |
|---|---|
| PubChem CID | 174760958 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-3-methoxypiperidine |
| SMILES | COC1CCCN(c2ccc([N+](=O)[O-])cc2Cl)C1 |
| InChI | InChI=1S/C12H15ClN2O3/c1-18-10-3-2-6-14(8-10)12-5-4-9(15(16)17)7-11(12)13/h4-5,7,10H,2-3,6,8H2,1H3 |
| InChIKey | KMQKZKNOXUUTBX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|