C14H21N3O4S — CID 39845926
1-(3,4-dimethyl-5-nitrophenyl)sulfonyl-4-ethylpiperazine (PubChem CID 39845926) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(3,4-dimethyl-5-nitrophenyl)sulfonyl-4-ethylpiperazine.
| Compound Name | 1-(3,4-dimethyl-5-nitrophenyl)sulfonyl-4-ethylpiperazine |
|---|---|
| PubChem CID | 39845926 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-(3,4-dimethyl-5-nitrophenyl)sulfonyl-4-ethylpiperazine |
| SMILES | CCN1CCN(S(=O)(=O)c2cc(C)c(C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-4-15-5-7-16(8-6-15)22(20,21)13-9-11(2)12(3)14(10-13)17(18)19/h9-10H,4-8H2,1-3H3 |
| InChIKey | MKZGOMZNMCKEFB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|