C21H22N4O3S — CID 4834365
3-[[4-(2-phenylethenylsulfonyl)piperazin-1-yl]methyl]quinazolin-4-one (PubChem CID 4834365) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 3-[[4-(2-phenylethenylsulfonyl)piperazin-1-yl]methyl]quinazolin-4-one.
| Compound Name | 3-[[4-(2-phenylethenylsulfonyl)piperazin-1-yl]methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4834365 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-[[4-(2-phenylethenylsulfonyl)piperazin-1-yl]methyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2ncn1CN1CCN(S(=O)(=O)C=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N4O3S/c26-21-19-8-4-5-9-20(19)22-16-24(21)17-23-11-13-25(14-12-23)29(27,28)15-10-18-6-2-1-3-7-18/h1-10,15-16H,11-14,17H2 |
| InChIKey | WSPUKCUCBAVHTF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |