C23H24N4O5S — CID 6216931
1-benzyl-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 6216931) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is 1-benzyl-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-benzyl-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 6216931 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-benzyl-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | O=C1C(=O)N(CN2CCN(S(=O)(=O)/C=C/c3ccccc3)CC2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H24N4O5S/c28-21-22(29)27(23(30)26(21)17-20-9-5-2-6-10-20)18-24-12-14-25(15-13-24)33(31,32)16-11-19-7-3-1-4-8-19/h1-11,16H,12-15,17-18H2/b16-11+ |
| InChIKey | DGYCRODKRWPMBV-LFIBNONCSA-N |
| XLogP | 1.55 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|