C16H15N3O3S — CID 51315920
3-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide (PubChem CID 51315920) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 51315920 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(4-methyl-1,3-thiazol-2-yl)methyl]propanamide |
| SMILES | Cc1csc(CNC(=O)CCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C16H15N3O3S/c1-10-9-23-14(18-10)8-17-13(20)6-7-19-15(21)11-4-2-3-5-12(11)16(19)22/h2-5,9H,6-8H2,1H3,(H,17,20) |
| InChIKey | ZZUOIHRQBCTRGE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|