C26H20N4O3S — CID 108766595
N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide (PubChem CID 108766595) has the molecular formula C26H20N4O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide.
| Compound Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 108766595 |
| Molecular Formula | C26H20N4O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | N-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]-1,3,4-thiadiazol-2-yl]-2,2-diphenylacetamide |
| SMILES | O=C(Nc1nnc(CCN2C(=O)c3ccccc3C2=O)s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H20N4O3S/c31-23(22(17-9-3-1-4-10-17)18-11-5-2-6-12-18)27-26-29-28-21(34-26)15-16-30-24(32)19-13-7-8-14-20(19)25(30)33/h1-14,22H,15-16H2,(H,27,29,31) |
| InChIKey | VXHFGFJSGOCYNC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|