C23H19NO4S2 — CID 19203351
ethyl 2-(naphthalen-2-ylsulfonylamino)-5-phenylthiophene-3-carboxylate (PubChem CID 19203351) has the molecular formula C23H19NO4S2 and a molecular weight of 437.54 g/mol. Its IUPAC name is ethyl 2-(naphthalen-2-ylsulfonylamino)-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(naphthalen-2-ylsulfonylamino)-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19203351 |
| Molecular Formula | C23H19NO4S2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | ethyl 2-(naphthalen-2-ylsulfonylamino)-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H19NO4S2/c1-2-28-23(25)20-15-21(17-9-4-3-5-10-17)29-22(20)24-30(26,27)19-13-12-16-8-6-7-11-18(16)14-19/h3-15,24H,2H2,1H3 |
| InChIKey | XJRKDTZVHNNLCC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |