C24H22N2O7S — CID 23991386
ethyl 2-[[2-(2-methyl-3-nitrobenzoyl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 23991386) has the molecular formula C24H22N2O7S and a molecular weight of 482.51 g/mol. Its IUPAC name is ethyl 2-[[2-(2-methyl-3-nitrobenzoyl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-methyl-3-nitrobenzoyl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23991386 |
| Molecular Formula | C24H22N2O7S |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | ethyl 2-[[2-(2-methyl-3-nitrobenzoyl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)COC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C24H22N2O7S/c1-4-32-24(29)21-18(16-10-8-14(2)9-11-16)13-34-22(21)25-20(27)12-33-23(28)17-6-5-7-19(15(17)3)26(30)31/h5-11,13H,4,12H2,1-3H3,(H,25,27) |
| InChIKey | VKGNTKZNCIUTTP-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|