C23H21N3O11S — CID 7903395
diethyl 3-methyl-5-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate (PubChem CID 7903395) has the molecular formula C23H21N3O11S and a molecular weight of 547.50 g/mol. Its IUPAC name is diethyl 3-methyl-5-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-5-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 7903395 |
| Molecular Formula | C23H21N3O11S |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | diethyl 3-methyl-5-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]thiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)COC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C23H21N3O11S/c1-4-35-22(31)16-11(3)18(23(32)36-5-2)38-19(16)24-14(27)10-37-15(28)9-25-20(29)12-7-6-8-13(26(33)34)17(12)21(25)30/h6-8H,4-5,9-10H2,1-3H3,(H,24,27) |
| InChIKey | HPHLKBOITFWUFY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 188.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|