C22H21N3O9 — CID 42976069
[2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 42976069) has the molecular formula C22H21N3O9 and a molecular weight of 471.42 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 42976069 |
| Molecular Formula | C22H21N3O9 |
| Molecular Weight | 471.42 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 2-(4-nitro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)CN2C(=O)c3cccc([N+](=O)[O-])c3C2=O)cc1OCC |
| InChI | InChI=1S/C22H21N3O9/c1-3-32-16-9-8-13(10-17(16)33-4-2)23-18(26)12-34-19(27)11-24-21(28)14-6-5-7-15(25(30)31)20(14)22(24)29/h5-10H,3-4,11-12H2,1-2H3,(H,23,26) |
| InChIKey | SFFLRKNGOBBNGF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|