C18H19N3O9 — CID 55304766
ethyl 4-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]butanoate (PubChem CID 55304766) has the molecular formula C18H19N3O9 and a molecular weight of 421.36 g/mol. Its IUPAC name is ethyl 4-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]butanoate |
|---|---|
| PubChem CID | 55304766 |
| Molecular Formula | C18H19N3O9 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | ethyl 4-[[2-[2-(4-nitro-1,3-dioxoisoindol-2-yl)acetyl]oxyacetyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)COC(=O)CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C18H19N3O9/c1-2-29-14(23)7-4-8-19-13(22)10-30-15(24)9-20-17(25)11-5-3-6-12(21(27)28)16(11)18(20)26/h3,5-6H,2,4,7-10H2,1H3,(H,19,22) |
| InChIKey | XEIZSZLRAIWPIE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 162.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|