C24H22Cl2N2O4S2 — CID 19188491
ethyl 2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 19188491) has the molecular formula C24H22Cl2N2O4S2 and a molecular weight of 537.49 g/mol. Its IUPAC name is ethyl 2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19188491 |
| Molecular Formula | C24H22Cl2N2O4S2 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | ethyl 2-[4-(2,4-dichlorophenoxy)butanoylcarbamothioylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=S)NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H22Cl2N2O4S2/c1-2-31-23(30)21-17(15-7-4-3-5-8-15)14-34-22(21)28-24(33)27-20(29)9-6-12-32-19-11-10-16(25)13-18(19)26/h3-5,7-8,10-11,13-14H,2,6,9,12H2,1H3,(H2,27,28,29,33) |
| InChIKey | LDYJTEFPHSUKBC-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|