C21H20FN3O3S — CID 2110612
ethyl 4-(4-fluorophenyl)-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]thiophene-3-carboxylate (PubChem CID 2110612) has the molecular formula C21H20FN3O3S and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2110612 |
| Molecular Formula | C21H20FN3O3S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-[[2-(pyridin-2-ylmethylamino)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CNCc1ccccn1 |
| InChI | InChI=1S/C21H20FN3O3S/c1-2-28-21(27)19-17(14-6-8-15(22)9-7-14)13-29-20(19)25-18(26)12-23-11-16-5-3-4-10-24-16/h3-10,13,23H,2,11-12H2,1H3,(H,25,26) |
| InChIKey | DQBVEJYDENNHIJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|