C16H19N3O3S — CID 142837418
ethyl 2-[[2-(ethylamino)acetyl]amino]-4-pyridin-4-ylthiophene-3-carboxylate (PubChem CID 142837418) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl 2-[[2-(ethylamino)acetyl]amino]-4-pyridin-4-ylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(ethylamino)acetyl]amino]-4-pyridin-4-ylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 142837418 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | ethyl 2-[[2-(ethylamino)acetyl]amino]-4-pyridin-4-ylthiophene-3-carboxylate |
| SMILES | CCNCC(=O)Nc1scc(-c2ccncc2)c1C(=O)OCC |
| InChI | InChI=1S/C16H19N3O3S/c1-3-17-9-13(20)19-15-14(16(21)22-4-2)12(10-23-15)11-5-7-18-8-6-11/h5-8,10,17H,3-4,9H2,1-2H3,(H,19,20) |
| InChIKey | HYHQMQPQBDCCMA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |