C18H14FN3O3S2 — CID 6469900
methyl 4-(4-fluorophenyl)-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate (PubChem CID 6469900) has the molecular formula C18H14FN3O3S2 and a molecular weight of 403.46 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6469900 |
| Molecular Formula | C18H14FN3O3S2 |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-[(2-pyrimidin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CSc1ncccn1 |
| InChI | InChI=1S/C18H14FN3O3S2/c1-25-17(24)15-13(11-3-5-12(19)6-4-11)9-26-16(15)22-14(23)10-27-18-20-7-2-8-21-18/h2-9H,10H2,1H3,(H,22,23) |
| InChIKey | JTPHISYQUSRSDM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|