C24H24N2O7S — CID 2954522
ethyl 2-[4-(2-methoxyphenoxy)butanoylamino]-4-(3-nitrophenyl)thiophene-3-carboxylate (PubChem CID 2954522) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is ethyl 2-[4-(2-methoxyphenoxy)butanoylamino]-4-(3-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[4-(2-methoxyphenoxy)butanoylamino]-4-(3-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2954522 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | ethyl 2-[4-(2-methoxyphenoxy)butanoylamino]-4-(3-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccc([N+](=O)[O-])c2)csc1NC(=O)CCCOc1ccccc1OC |
| InChI | InChI=1S/C24H24N2O7S/c1-3-32-24(28)22-18(16-8-6-9-17(14-16)26(29)30)15-34-23(22)25-21(27)12-7-13-33-20-11-5-4-10-19(20)31-2/h4-6,8-11,14-15H,3,7,12-13H2,1-2H3,(H,25,27) |
| InChIKey | PKMZTANPRAIEGV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|