C25H26BrNO4S — CID 19218455
ethyl 2-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 19218455) has the molecular formula C25H26BrNO4S and a molecular weight of 516.46 g/mol. Its IUPAC name is ethyl 2-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19218455 |
| Molecular Formula | C25H26BrNO4S |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | ethyl 2-[[2-(4-bromo-2,6-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2C)csc1NC(=O)COc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C25H26BrNO4S/c1-6-30-25(29)22-20(19-8-7-14(2)9-15(19)3)13-32-24(22)27-21(28)12-31-23-16(4)10-18(26)11-17(23)5/h7-11,13H,6,12H2,1-5H3,(H,27,28) |
| InChIKey | SIRGGUYWRXSGGY-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|