C22H20BrNO4S — CID 2241885
methyl 4-(4-bromophenyl)-2-[[2-(2,4-dimethylphenoxy)acetyl]amino]thiophene-3-carboxylate (PubChem CID 2241885) has the molecular formula C22H20BrNO4S and a molecular weight of 474.38 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[[2-(2,4-dimethylphenoxy)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[[2-(2,4-dimethylphenoxy)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2241885 |
| Molecular Formula | C22H20BrNO4S |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[[2-(2,4-dimethylphenoxy)acetyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)COc1ccc(C)cc1C |
| InChI | InChI=1S/C22H20BrNO4S/c1-13-4-9-18(14(2)10-13)28-11-19(25)24-21-20(22(26)27-3)17(12-29-21)15-5-7-16(23)8-6-15/h4-10,12H,11H2,1-3H3,(H,24,25) |
| InChIKey | VGNJFXANIQKAEO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|