C24H18BrNO4S — CID 3389569
methyl 4-(4-bromophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]thiophene-3-carboxylate (PubChem CID 3389569) has the molecular formula C24H18BrNO4S and a molecular weight of 496.38 g/mol. Its IUPAC name is methyl 4-(4-bromophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-bromophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3389569 |
| Molecular Formula | C24H18BrNO4S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | methyl 4-(4-bromophenyl)-2-[(2-naphthalen-2-yloxyacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18BrNO4S/c1-29-24(28)22-20(16-6-9-18(25)10-7-16)14-31-23(22)26-21(27)13-30-19-11-8-15-4-2-3-5-17(15)12-19/h2-12,14H,13H2,1H3,(H,26,27) |
| InChIKey | DYXWLBOYCQZCNK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|