C25H21NO6S — CID 19204802
methyl 2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19204802) has the molecular formula C25H21NO6S and a molecular weight of 463.51 g/mol. Its IUPAC name is methyl 2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19204802 |
| Molecular Formula | C25H21NO6S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | methyl 2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)COc1ccc2c(C)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H21NO6S/c1-14-4-6-16(7-5-14)19-13-33-24(23(19)25(29)30-3)26-21(27)12-31-17-8-9-18-15(2)10-22(28)32-20(18)11-17/h4-11,13H,12H2,1-3H3,(H,26,27) |
| InChIKey | ULNLTWXZHPQHKZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|