C29H24N2O4S — CID 108738431
2-(4-methyl-2-oxochromen-7-yl)oxy-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]acetamide (PubChem CID 108738431) has the molecular formula C29H24N2O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 108738431 |
| Molecular Formula | C29H24N2O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 2-(4-methyl-2-oxochromen-7-yl)oxy-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]acetamide |
| SMILES | Cc1ccc(-c2csc(-c3ccc(CNC(=O)COc4ccc5c(C)cc(=O)oc5c4)cc3)n2)cc1 |
| InChI | InChI=1S/C29H24N2O4S/c1-18-3-7-21(8-4-18)25-17-36-29(31-25)22-9-5-20(6-10-22)15-30-27(32)16-34-23-11-12-24-19(2)13-28(33)35-26(24)14-23/h3-14,17H,15-16H2,1-2H3,(H,30,32) |
| InChIKey | GTEPENGCCDKOQB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|