C22H21FN2O6 — CID 4246306
N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanamide (PubChem CID 4246306) has the molecular formula C22H21FN2O6 and a molecular weight of 428.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanamide |
|---|---|
| PubChem CID | 4246306 |
| Molecular Formula | C22H21FN2O6 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-hydroxy-2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)NC(CO)C(=O)NCc3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C22H21FN2O6/c1-13-8-21(28)31-19-9-16(6-7-17(13)19)30-12-20(27)25-18(11-26)22(29)24-10-14-2-4-15(23)5-3-14/h2-9,18,26H,10-12H2,1H3,(H,24,29)(H,25,27) |
| InChIKey | KNWNUVKOYRYEJW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|