C20H16N2O7 — CID 108733969
methyl 4-cyano-2-methyl-5-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]furan-3-carboxylate (PubChem CID 108733969) has the molecular formula C20H16N2O7 and a molecular weight of 396.36 g/mol. Its IUPAC name is methyl 4-cyano-2-methyl-5-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]furan-3-carboxylate.
| Compound Name | methyl 4-cyano-2-methyl-5-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]furan-3-carboxylate |
|---|---|
| PubChem CID | 108733969 |
| Molecular Formula | C20H16N2O7 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | methyl 4-cyano-2-methyl-5-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]furan-3-carboxylate |
| SMILES | COC(=O)c1c(C)oc(NC(=O)COc2ccc3c(C)cc(=O)oc3c2)c1C#N |
| InChI | InChI=1S/C20H16N2O7/c1-10-6-17(24)29-15-7-12(4-5-13(10)15)27-9-16(23)22-19-14(8-21)18(11(2)28-19)20(25)26-3/h4-7H,9H2,1-3H3,(H,22,23) |
| InChIKey | PSQCAYVYPLWWNW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|