C27H22FNO6S — CID 19204671
ethyl 4-(4-fluorophenyl)-2-[[2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetyl]amino]thiophene-3-carboxylate (PubChem CID 19204671) has the molecular formula C27H22FNO6S and a molecular weight of 507.54 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-2-[[2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-2-[[2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19204671 |
| Molecular Formula | C27H22FNO6S |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-2-[[2-[(4-oxo-2,3-dihydro-1H-cyclopenta[c]chromen-7-yl)oxy]acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)COc1ccc2c3c(c(=O)oc2c1)CCC3 |
| InChI | InChI=1S/C27H22FNO6S/c1-2-33-27(32)24-21(15-6-8-16(28)9-7-15)14-36-25(24)29-23(30)13-34-17-10-11-19-18-4-3-5-20(18)26(31)35-22(19)12-17/h6-12,14H,2-5,13H2,1H3,(H,29,30) |
| InChIKey | WKKPAHZJQAEIAG-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|