C20H24FN2O4S+ — CID 2098851
[2-[[3-ethoxycarbonyl-4-(4-fluorophenyl)thiophen-2-yl]amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium (PubChem CID 2098851) has the molecular formula C20H24FN2O4S+ and a molecular weight of 407.49 g/mol. Its IUPAC name is [2-[[3-ethoxycarbonyl-4-(4-fluorophenyl)thiophen-2-yl]amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium.
| Compound Name | [2-[[3-ethoxycarbonyl-4-(4-fluorophenyl)thiophen-2-yl]amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
|---|---|
| PubChem CID | 2098851 |
| Molecular Formula | C20H24FN2O4S+ |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | [2-[[3-ethoxycarbonyl-4-(4-fluorophenyl)thiophen-2-yl]amino]-2-oxoethyl]-[[(2R)-oxolan-2-yl]methyl]azanium |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)C[NH2+]C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H23FN2O4S/c1-2-26-20(25)18-16(13-5-7-14(21)8-6-13)12-28-19(18)23-17(24)11-22-10-15-4-3-9-27-15/h5-8,12,15,22H,2-4,9-11H2,1H3,(H,23,24)/p+1/t15-/m1/s1 |
| InChIKey | HDXHCRZOCKMKHP-OAHLLOKOSA-O |
| XLogP | 2.41 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|