C22H26FN3O4S — CID 24561254
ethyl 2-[[2-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate (PubChem CID 24561254) has the molecular formula C22H26FN3O4S and a molecular weight of 447.53 g/mol. Its IUPAC name is ethyl 2-[[2-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 24561254 |
| Molecular Formula | C22H26FN3O4S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | ethyl 2-[[2-[2-(dimethylcarbamoyl)pyrrolidin-1-yl]acetyl]amino]-4-(4-fluorophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CN1CCCC1C(=O)N(C)C |
| InChI | InChI=1S/C22H26FN3O4S/c1-4-30-22(29)19-16(14-7-9-15(23)10-8-14)13-31-20(19)24-18(27)12-26-11-5-6-17(26)21(28)25(2)3/h7-10,13,17H,4-6,11-12H2,1-3H3,(H,24,27) |
| InChIKey | GUTLFNQSFJHJBV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|