C25H27NO4S — CID 19218177
ethyl 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 19218177) has the molecular formula C25H27NO4S and a molecular weight of 437.56 g/mol. Its IUPAC name is ethyl 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19218177 |
| Molecular Formula | C25H27NO4S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | ethyl 2-[[2-(2,3-dimethylphenoxy)acetyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2C)csc1NC(=O)COc1cccc(C)c1C |
| InChI | InChI=1S/C25H27NO4S/c1-6-29-25(28)23-20(19-11-10-15(2)12-17(19)4)14-31-24(23)26-22(27)13-30-21-9-7-8-16(3)18(21)5/h7-12,14H,6,13H2,1-5H3,(H,26,27) |
| InChIKey | RWIBAYMLFPOJAW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|