C21H17Cl2NO3S — CID 2241844
methyl 2-[(3,4-dichlorobenzoyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 2241844) has the molecular formula C21H17Cl2NO3S and a molecular weight of 434.34 g/mol. Its IUPAC name is methyl 2-[(3,4-dichlorobenzoyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(3,4-dichlorobenzoyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 2241844 |
| Molecular Formula | C21H17Cl2NO3S |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | methyl 2-[(3,4-dichlorobenzoyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2NO3S/c1-11-4-5-13(8-12(11)2)15-10-28-20(18(15)21(26)27-3)24-19(25)14-6-7-16(22)17(23)9-14/h4-10H,1-3H3,(H,24,25) |
| InChIKey | GKGCEKFPLFYVAH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|