C19H16N2O5S — CID 55876306
methyl 2-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]amino]thiophene-3-carboxylate (PubChem CID 55876306) has the molecular formula C19H16N2O5S and a molecular weight of 384.41 g/mol. Its IUPAC name is methyl 2-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 55876306 |
| Molecular Formula | C19H16N2O5S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | methyl 2-[[3-(furan-2-carbonylamino)-4-methylbenzoyl]amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C19H16N2O5S/c1-11-5-6-12(10-14(11)20-17(23)15-4-3-8-26-15)16(22)21-18-13(7-9-27-18)19(24)25-2/h3-10H,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | OJCVYBSBJZAYFI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |