C25H22ClNO4S2 — CID 19225743
ethyl 2-[(3-chloro-5-methoxy-1-benzothiophene-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 19225743) has the molecular formula C25H22ClNO4S2 and a molecular weight of 500.04 g/mol. Its IUPAC name is ethyl 2-[(3-chloro-5-methoxy-1-benzothiophene-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-chloro-5-methoxy-1-benzothiophene-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19225743 |
| Molecular Formula | C25H22ClNO4S2 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | ethyl 2-[(3-chloro-5-methoxy-1-benzothiophene-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)c1sc2ccc(OC)cc2c1Cl |
| InChI | InChI=1S/C25H22ClNO4S2/c1-5-31-25(29)20-18(15-7-6-13(2)14(3)10-15)12-32-24(20)27-23(28)22-21(26)17-11-16(30-4)8-9-19(17)33-22/h6-12H,5H2,1-4H3,(H,27,28) |
| InChIKey | VOYOGCWMOXMAKA-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|