C27H27ClN2O3S — CID 110503901
ethyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 110503901) has the molecular formula C27H27ClN2O3S and a molecular weight of 495.04 g/mol. Its IUPAC name is ethyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503901 |
| Molecular Formula | C27H27ClN2O3S |
| Molecular Weight | 495.04 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | ethyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(3,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)c(C)c2)csc1NC(=O)c1c(C)c2cc(Cl)ccc2n1CC |
| InChI | InChI=1S/C27H27ClN2O3S/c1-6-30-22-11-10-19(28)13-20(22)17(5)24(30)25(31)29-26-23(27(32)33-7-2)21(14-34-26)18-9-8-15(3)16(4)12-18/h8-14H,6-7H2,1-5H3,(H,29,31) |
| InChIKey | HTAKLPNVEZHBEH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.04 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|