C26H25ClN2O3S — CID 110503934
methyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 110503934) has the molecular formula C26H25ClN2O3S and a molecular weight of 481.02 g/mol. Its IUPAC name is methyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503934 |
| Molecular Formula | C26H25ClN2O3S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | methyl 2-[(5-chloro-1-ethyl-3-methylindole-2-carbonyl)amino]-4-(2,5-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCn1c(C(=O)Nc2scc(-c3cc(C)ccc3C)c2C(=O)OC)c(C)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H25ClN2O3S/c1-6-29-21-10-9-17(27)12-19(21)16(4)23(29)24(30)28-25-22(26(31)32-5)20(13-33-25)18-11-14(2)7-8-15(18)3/h7-13H,6H2,1-5H3,(H,28,30) |
| InChIKey | INMLHXJPHSVXBH-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|