C26H25NO3S2 — CID 110503376
methyl 4-(2,5-dimethylphenyl)-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 110503376) has the molecular formula C26H25NO3S2 and a molecular weight of 463.62 g/mol. Its IUPAC name is methyl 4-(2,5-dimethylphenyl)-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2,5-dimethylphenyl)-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503376 |
| Molecular Formula | C26H25NO3S2 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | methyl 4-(2,5-dimethylphenyl)-2-[(3-propyl-1-benzothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCCc1c(C(=O)Nc2scc(-c3cc(C)ccc3C)c2C(=O)OC)sc2ccccc12 |
| InChI | InChI=1S/C26H25NO3S2/c1-5-8-18-17-9-6-7-10-21(17)32-23(18)24(28)27-25-22(26(29)30-4)20(14-31-25)19-13-15(2)11-12-16(19)3/h6-7,9-14H,5,8H2,1-4H3,(H,27,28) |
| InChIKey | CKPOQGFEALTGCP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|