C21H20N2O3S2 — CID 19727883
methyl 4-(2,5-dimethylphenyl)-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate (PubChem CID 19727883) has the molecular formula C21H20N2O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is methyl 4-(2,5-dimethylphenyl)-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(2,5-dimethylphenyl)-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19727883 |
| Molecular Formula | C21H20N2O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | methyl 4-(2,5-dimethylphenyl)-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2cc(C)ccc2C)csc1NC(=O)CSc1ccccn1 |
| InChI | InChI=1S/C21H20N2O3S2/c1-13-7-8-14(2)15(10-13)16-11-28-20(19(16)21(25)26-3)23-17(24)12-27-18-6-4-5-9-22-18/h4-11H,12H2,1-3H3,(H,23,24) |
| InChIKey | RJXYQCAZQLWEDQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|