C30H24N2O5S2 — CID 110503273
ethyl 2-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate (PubChem CID 110503273) has the molecular formula C30H24N2O5S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is ethyl 2-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503273 |
| Molecular Formula | C30H24N2O5S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.11 |
| IUPAC Name | ethyl 2-[[3-[(4-methylphenyl)methyl]-1-benzothiophene-2-carbonyl]amino]-4-(4-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc([N+](=O)[O-])cc2)csc1NC(=O)c1sc2ccccc2c1Cc1ccc(C)cc1 |
| InChI | InChI=1S/C30H24N2O5S2/c1-3-37-30(34)26-24(20-12-14-21(15-13-20)32(35)36)17-38-29(26)31-28(33)27-23(16-19-10-8-18(2)9-11-19)22-6-4-5-7-25(22)39-27/h4-15,17H,3,16H2,1-2H3,(H,31,33) |
| InChIKey | BPLGLJPBBGBWNC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|