C27H27N3O5S — CID 110503552
ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-(4-nitrophenyl)thiophene-3-carboxylate (PubChem CID 110503552) has the molecular formula C27H27N3O5S and a molecular weight of 505.60 g/mol. Its IUPAC name is ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-(4-nitrophenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-(4-nitrophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503552 |
| Molecular Formula | C27H27N3O5S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | ethyl 2-[(1-butyl-3-methylindole-2-carbonyl)amino]-4-(4-nitrophenyl)thiophene-3-carboxylate |
| SMILES | CCCCn1c(C(=O)Nc2scc(-c3ccc([N+](=O)[O-])cc3)c2C(=O)OCC)c(C)c2ccccc21 |
| InChI | InChI=1S/C27H27N3O5S/c1-4-6-15-29-22-10-8-7-9-20(22)17(3)24(29)25(31)28-26-23(27(32)35-5-2)21(16-36-26)18-11-13-19(14-12-18)30(33)34/h7-14,16H,4-6,15H2,1-3H3,(H,28,31) |
| InChIKey | DHEMDEJFWTXWCW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|