C21H21NO3S2 — CID 995720
ethyl 4-(2,5-dimethylphenyl)-2-[(3-methylthiophene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 995720) has the molecular formula C21H21NO3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is ethyl 4-(2,5-dimethylphenyl)-2-[(3-methylthiophene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2,5-dimethylphenyl)-2-[(3-methylthiophene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 995720 |
| Molecular Formula | C21H21NO3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | ethyl 4-(2,5-dimethylphenyl)-2-[(3-methylthiophene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cc(C)ccc2C)csc1NC(=O)c1sccc1C |
| InChI | InChI=1S/C21H21NO3S2/c1-5-25-21(24)17-16(15-10-12(2)6-7-13(15)3)11-27-20(17)22-19(23)18-14(4)8-9-26-18/h6-11H,5H2,1-4H3,(H,22,23) |
| InChIKey | CILMAIUTJBJYIE-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|