C32H36N2O4S — CID 110503820
ethyl 2-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate (PubChem CID 110503820) has the molecular formula C32H36N2O4S and a molecular weight of 544.72 g/mol. Its IUPAC name is ethyl 2-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 110503820 |
| Molecular Formula | C32H36N2O4S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | ethyl 2-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]-4-(4-propoxyphenyl)thiophene-3-carboxylate |
| SMILES | C=CCn1c(C(=O)Nc2scc(-c3ccc(OCCC)cc3)c2C(=O)OCC)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C32H36N2O4S/c1-7-16-34-27-15-12-23(20(4)5)18-25(27)21(6)29(34)30(35)33-31-28(32(36)37-9-3)26(19-39-31)22-10-13-24(14-11-22)38-17-8-2/h7,10-15,18-20H,1,8-9,16-17H2,2-6H3,(H,33,35) |
| InChIKey | IJUHVGOWWRXCEX-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|