C22H24N2O3S — CID 110502035
methyl 3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 110502035) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is methyl 3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 110502035 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl 3-[(3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | C=CCn1c(C(=O)Nc2ccsc2C(=O)OC)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C22H24N2O3S/c1-6-10-24-18-8-7-15(13(2)3)12-16(18)14(4)19(24)21(25)23-17-9-11-28-20(17)22(26)27-5/h6-9,11-13H,1,10H2,2-5H3,(H,23,25) |
| InChIKey | JUXLBGPDBZFAQV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|