C23H25ClN2O — CID 110497639
N-[(4-chlorophenyl)methyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide (PubChem CID 110497639) has the molecular formula C23H25ClN2O and a molecular weight of 380.92 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 110497639 |
| Molecular Formula | C23H25ClN2O |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-3-methyl-5-propan-2-yl-1-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCn1c(C(=O)NCc2ccc(Cl)cc2)c(C)c2cc(C(C)C)ccc21 |
| InChI | InChI=1S/C23H25ClN2O/c1-5-12-26-21-11-8-18(15(2)3)13-20(21)16(4)22(26)23(27)25-14-17-6-9-19(24)10-7-17/h5-11,13,15H,1,12,14H2,2-4H3,(H,25,27) |
| InChIKey | NGDBWMBJJRNMHR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|